C13H12F3N3O5 — CID 102583597
(3aR,4R,9bS)-2-methyl-3a,8-dinitro-4-(trifluoromethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole (PubChem CID 102583597) has the molecular formula C13H12F3N3O5 and a molecular weight of 347.25 g/mol. Its IUPAC name is (3aR,4R,9bS)-2-methyl-3a,8-dinitro-4-(trifluoromethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole.
| Compound Name | (3aR,4R,9bS)-2-methyl-3a,8-dinitro-4-(trifluoromethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 102583597 |
| Molecular Formula | C13H12F3N3O5 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (3aR,4R,9bS)-2-methyl-3a,8-dinitro-4-(trifluoromethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole |
| SMILES | CN1C[C@@H]2c3cc([N+](=O)[O-])ccc3O[C@@H](C(F)(F)F)[C@]2([N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H12F3N3O5/c1-17-5-9-8-4-7(18(20)21)2-3-10(8)24-11(13(14,15)16)12(9,6-17)19(22)23/h2-4,9,11H,5-6H2,1H3/t9-,11-,12+/m1/s1 |
| InChIKey | FAORFPSZLUQFAB-JLLWLGSASA-N |
| XLogP | 1.96 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|