C13H16N2O3 — CID 87467622
(3S,5S)-1,3-dimethyl-5-nitro-5-phenylpiperidin-2-one (PubChem CID 87467622) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3S,5S)-1,3-dimethyl-5-nitro-5-phenylpiperidin-2-one.
| Compound Name | (3S,5S)-1,3-dimethyl-5-nitro-5-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 87467622 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3S,5S)-1,3-dimethyl-5-nitro-5-phenylpiperidin-2-one |
| SMILES | C[C@H]1C[C@@](c2ccccc2)([N+](=O)[O-])CN(C)C1=O |
| InChI | InChI=1S/C13H16N2O3/c1-10-8-13(15(17)18,9-14(2)12(10)16)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | YJWZXVAJNQYOGT-GXFFZTMASA-N |
| XLogP | 1.66 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|