C19H27N3O6 — CID 102189054
ethyl 2-[4-(2-ethoxy-2-oxoethyl)-6-nitro-6-phenyl-1,4-diazepan-1-yl]acetate (PubChem CID 102189054) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 2-[4-(2-ethoxy-2-oxoethyl)-6-nitro-6-phenyl-1,4-diazepan-1-yl]acetate.
| Compound Name | ethyl 2-[4-(2-ethoxy-2-oxoethyl)-6-nitro-6-phenyl-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 102189054 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | ethyl 2-[4-(2-ethoxy-2-oxoethyl)-6-nitro-6-phenyl-1,4-diazepan-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC(=O)OCC)CC(c2ccccc2)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H27N3O6/c1-3-27-17(23)12-20-10-11-21(13-18(24)28-4-2)15-19(14-20,22(25)26)16-8-6-5-7-9-16/h5-9H,3-4,10-15H2,1-2H3 |
| InChIKey | AHEALMQLUKIZSZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|