C14H24N4O6S2 — CID 153326071
diazanium;5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate (PubChem CID 153326071) has the molecular formula C14H24N4O6S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is diazanium;5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate.
| Compound Name | diazanium;5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate |
|---|---|
| PubChem CID | 153326071 |
| Molecular Formula | C14H24N4O6S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | diazanium;5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate |
| SMILES | NC1(N)C=CC(C=Cc2ccccc2)C(S(=O)(=O)[O-])(S(=O)(=O)[O-])C1.[NH4+].[NH4+] |
| InChI | InChI=1S/C14H18N2O6S2.2H3N/c15-13(16)9-8-12(7-6-11-4-2-1-3-5-11)14(10-13,23(17,18)19)24(20,21)22;;/h1-9,12H,10,15-16H2,(H,17,18,19)(H,20,21,22);2*1H3 |
| InChIKey | PREWRAUIRAHGTD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 239.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|