C20H18Br2O — CID 11453292
trans-(3S,5S)-3,5-bis(4-bromophenyl)-4-ethenylcyclohexan-1-one (PubChem CID 11453292) has the molecular formula C20H18Br2O and a molecular weight of 434.17 g/mol. Its IUPAC name is trans-(3S,5S)-3,5-bis(4-bromophenyl)-4-ethenylcyclohexan-1-one.
| Compound Name | trans-(3S,5S)-3,5-bis(4-bromophenyl)-4-ethenylcyclohexan-1-one |
|---|---|
| PubChem CID | 11453292 |
| Molecular Formula | C20H18Br2O |
| Molecular Weight | 434.17 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | trans-(3S,5S)-3,5-bis(4-bromophenyl)-4-ethenylcyclohexan-1-one |
| SMILES | C=CC1[C@@H](c2ccc(Br)cc2)CC(=O)C[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18Br2O/c1-2-18-19(13-3-7-15(21)8-4-13)11-17(23)12-20(18)14-5-9-16(22)10-6-14/h2-10,18-20H,1,11-12H2/t19-,20-/m1/s1 |
| InChIKey | DLLKAGMVPKAPJT-WOJBJXKFSA-N |
| XLogP | 6.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.17 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|