C24H20N6O8 — CID 139236480
1,3,3'-trimethyl-4',6'-bis(4-nitrophenyl)spiro[1,3-diazinane-5,5'-6,7-dihydro-4H-[1,2]oxazolo[5,4-b]pyridine]-2,4,6-trione (PubChem CID 139236480) has the molecular formula C24H20N6O8 and a molecular weight of 520.46 g/mol. Its IUPAC name is 1,3,3'-trimethyl-4',6'-bis(4-nitrophenyl)spiro[1,3-diazinane-5,5'-6,7-dihydro-4H-[1,2]oxazolo[5,4-b]pyridine]-2,4,6-trione.
| Compound Name | 1,3,3'-trimethyl-4',6'-bis(4-nitrophenyl)spiro[1,3-diazinane-5,5'-6,7-dihydro-4H-[1,2]oxazolo[5,4-b]pyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 139236480 |
| Molecular Formula | C24H20N6O8 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 1,3,3'-trimethyl-4',6'-bis(4-nitrophenyl)spiro[1,3-diazinane-5,5'-6,7-dihydro-4H-[1,2]oxazolo[5,4-b]pyridine]-2,4,6-trione |
| SMILES | Cc1noc2c1C(c1ccc([N+](=O)[O-])cc1)C1(C(=O)N(C)C(=O)N(C)C1=O)C(c1ccc([N+](=O)[O-])cc1)N2 |
| InChI | InChI=1S/C24H20N6O8/c1-12-17-18(13-4-8-15(9-5-13)29(34)35)24(21(31)27(2)23(33)28(3)22(24)32)19(25-20(17)38-26-12)14-6-10-16(11-7-14)30(36)37/h4-11,18-19,25H,1-3H3 |
| InChIKey | SYUKFWGJLMJWDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 182.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|