C19H19N5O7 — CID 102262096
1,1',3,3'-tetramethyl-5'-(4-nitrophenyl)spiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone (PubChem CID 102262096) has the molecular formula C19H19N5O7 and a molecular weight of 429.39 g/mol. Its IUPAC name is 1,1',3,3'-tetramethyl-5'-(4-nitrophenyl)spiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone.
| Compound Name | 1,1',3,3'-tetramethyl-5'-(4-nitrophenyl)spiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone |
|---|---|
| PubChem CID | 102262096 |
| Molecular Formula | C19H19N5O7 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1,1',3,3'-tetramethyl-5'-(4-nitrophenyl)spiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone |
| SMILES | CN1CN(C)C(=O)C2(Oc3c(c(=O)n(C)c(=O)n3C)C2c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C19H19N5O7/c1-20-9-21(2)17(27)19(16(20)26)13(10-5-7-11(8-6-10)24(29)30)12-14(25)22(3)18(28)23(4)15(12)31-19/h5-8,13H,9H2,1-4H3 |
| InChIKey | GCHZVFCMMZTSTC-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 136.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|