C22H21N3O6 — CID 101117534
(5S,7R)-7-(4-methoxyphenyl)-1,3-dimethyl-5-(4-nitrophenyl)-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione (PubChem CID 101117534) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is (5S,7R)-7-(4-methoxyphenyl)-1,3-dimethyl-5-(4-nitrophenyl)-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (5S,7R)-7-(4-methoxyphenyl)-1,3-dimethyl-5-(4-nitrophenyl)-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101117534 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (5S,7R)-7-(4-methoxyphenyl)-1,3-dimethyl-5-(4-nitrophenyl)-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc([C@H]2C[C@@H](c3ccc([N+](=O)[O-])cc3)c3c(n(C)c(=O)n(C)c3=O)O2)cc1 |
| InChI | InChI=1S/C22H21N3O6/c1-23-20(26)19-17(13-4-8-15(9-5-13)25(28)29)12-18(31-21(19)24(2)22(23)27)14-6-10-16(30-3)11-7-14/h4-11,17-18H,12H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | GCGNGLRVMCRALZ-ZWKOTPCHSA-N |
| XLogP | 2.66 |
| TPSA | 105.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|