C20H22N4O6 — CID 102262091
5'-(4-methoxyphenyl)-1,1',3,3'-tetramethylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone (PubChem CID 102262091) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is 5'-(4-methoxyphenyl)-1,1',3,3'-tetramethylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone.
| Compound Name | 5'-(4-methoxyphenyl)-1,1',3,3'-tetramethylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone |
|---|---|
| PubChem CID | 102262091 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 5'-(4-methoxyphenyl)-1,1',3,3'-tetramethylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2',4,4',6-tetrone |
| SMILES | COc1ccc(C2c3c(n(C)c(=O)n(C)c3=O)OC23C(=O)N(C)CN(C)C3=O)cc1 |
| InChI | InChI=1S/C20H22N4O6/c1-21-10-22(2)18(27)20(17(21)26)14(11-6-8-12(29-5)9-7-11)13-15(25)23(3)19(28)24(4)16(13)30-20/h6-9,14H,10H2,1-5H3 |
| InChIKey | MTZPAXIMSNXRQF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 103.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|