C21H28N2O6 — CID 134866559
(5S,6R)-7,7-diethoxy-5-(4-methoxyphenyl)-1,3,6-trimethyl-5,6-dihydropyrano[2,3-d]pyrimidine-2,4-dione (PubChem CID 134866559) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is (5S,6R)-7,7-diethoxy-5-(4-methoxyphenyl)-1,3,6-trimethyl-5,6-dihydropyrano[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (5S,6R)-7,7-diethoxy-5-(4-methoxyphenyl)-1,3,6-trimethyl-5,6-dihydropyrano[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134866559 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (5S,6R)-7,7-diethoxy-5-(4-methoxyphenyl)-1,3,6-trimethyl-5,6-dihydropyrano[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCOC1(OCC)Oc2c(c(=O)n(C)c(=O)n2C)[C@H](c2ccc(OC)cc2)[C@H]1C |
| InChI | InChI=1S/C21H28N2O6/c1-7-27-21(28-8-2)13(3)16(14-9-11-15(26-6)12-10-14)17-18(24)22(4)20(25)23(5)19(17)29-21/h9-13,16H,7-8H2,1-6H3/t13-,16+/m1/s1 |
| InChIKey | UPMMAJMGJGLHTI-CJNGLKHVSA-N |
| XLogP | 1.98 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|