C18H17N5O6 — CID 11488474
1,1',3,3'-tetramethyl-5'-pyridin-3-ylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2,2',4,4',6-pentone (PubChem CID 11488474) has the molecular formula C18H17N5O6 and a molecular weight of 399.36 g/mol. Its IUPAC name is 1,1',3,3'-tetramethyl-5'-pyridin-3-ylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2,2',4,4',6-pentone.
| Compound Name | 1,1',3,3'-tetramethyl-5'-pyridin-3-ylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2,2',4,4',6-pentone |
|---|---|
| PubChem CID | 11488474 |
| Molecular Formula | C18H17N5O6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1,1',3,3'-tetramethyl-5'-pyridin-3-ylspiro[1,3-diazinane-5,6'-5H-furo[2,3-d]pyrimidine]-2,2',4,4',6-pentone |
| SMILES | CN1C(=O)N(C)C(=O)C2(Oc3c(c(=O)n(C)c(=O)n3C)C2c2cccnc2)C1=O |
| InChI | InChI=1S/C18H17N5O6/c1-20-12(24)10-11(9-6-5-7-19-8-9)18(29-13(10)21(2)16(20)27)14(25)22(3)17(28)23(4)15(18)26/h5-8,11H,1-4H3 |
| InChIKey | GRIBSPILBGKQNM-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 123.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|