C19H25N6O2+ — CID 153454337
1,3,7-trimethyl-8-[(1-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-yl)methyl]purine-2,6-dione (PubChem CID 153454337) has the molecular formula C19H25N6O2+ and a molecular weight of 369.45 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[(1-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-yl)methyl]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[(1-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 153454337 |
| Molecular Formula | C19H25N6O2+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1,3,7-trimethyl-8-[(1-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-yl)methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(C[N+]3(C)CCCC3c3cccnc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C19H25N6O2/c1-22-15(21-17-16(22)18(26)24(3)19(27)23(17)2)12-25(4)10-6-8-14(25)13-7-5-9-20-11-13/h5,7,9,11,14H,6,8,10,12H2,1-4H3/q+1 |
| InChIKey | ANRRDNBMQGDYMN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|