C16H24N2O3 — CID 12682591
(6aS,9R,10aS)-2,4,6,6,9-pentamethyl-6a,7,8,9,10,10a-hexahydroisochromeno[3,4-d]pyrimidine-1,3-dione (PubChem CID 12682591) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (6aS,9R,10aS)-2,4,6,6,9-pentamethyl-6a,7,8,9,10,10a-hexahydroisochromeno[3,4-d]pyrimidine-1,3-dione.
| Compound Name | (6aS,9R,10aS)-2,4,6,6,9-pentamethyl-6a,7,8,9,10,10a-hexahydroisochromeno[3,4-d]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 12682591 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (6aS,9R,10aS)-2,4,6,6,9-pentamethyl-6a,7,8,9,10,10a-hexahydroisochromeno[3,4-d]pyrimidine-1,3-dione |
| SMILES | C[C@@H]1CC[C@H]2[C@H](C1)c1c(n(C)c(=O)n(C)c1=O)OC2(C)C |
| InChI | InChI=1S/C16H24N2O3/c1-9-6-7-11-10(8-9)12-13(19)17(4)15(20)18(5)14(12)21-16(11,2)3/h9-11H,6-8H2,1-5H3/t9-,10+,11+/m1/s1 |
| InChIKey | JTDKVDHTJCNREV-VWYCJHECSA-N |
| XLogP | 1.77 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |