C20H17N5O4 — CID 11406665
1,3-dimethyl-5-(4-nitrophenyl)-6-phenyl-5H-pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 11406665) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-nitrophenyl)-6-phenyl-5H-pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(4-nitrophenyl)-6-phenyl-5H-pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11406665 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1,3-dimethyl-5-(4-nitrophenyl)-6-phenyl-5H-pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1ccc([N+](=O)[O-])cc1)N(c1ccccc1)C=N2 |
| InChI | InChI=1S/C20H17N5O4/c1-22-18-16(19(26)23(2)20(22)27)17(13-8-10-15(11-9-13)25(28)29)24(12-21-18)14-6-4-3-5-7-14/h3-12,17H,1-2H3 |
| InChIKey | WXRAILMZKPAYNJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 102.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|