C21H20N6O6 — CID 177409698
11,13-bis(4-nitrophenyl)-5,9,11,13-tetrazatricyclo[7.4.0.01,5]tridecane-10,12-dione (PubChem CID 177409698) has the molecular formula C21H20N6O6 and a molecular weight of 452.43 g/mol. Its IUPAC name is 11,13-bis(4-nitrophenyl)-5,9,11,13-tetrazatricyclo[7.4.0.01,5]tridecane-10,12-dione.
| Compound Name | 11,13-bis(4-nitrophenyl)-5,9,11,13-tetrazatricyclo[7.4.0.01,5]tridecane-10,12-dione |
|---|---|
| PubChem CID | 177409698 |
| Molecular Formula | C21H20N6O6 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 11,13-bis(4-nitrophenyl)-5,9,11,13-tetrazatricyclo[7.4.0.01,5]tridecane-10,12-dione |
| SMILES | O=C1N(c2ccc([N+](=O)[O-])cc2)C(=O)N(c2ccc([N+](=O)[O-])cc2)C23CCCN2CCCN13 |
| InChI | InChI=1S/C21H20N6O6/c28-19-23-14-2-13-22-12-1-11-21(22,23)25(16-5-9-18(10-6-16)27(32)33)20(29)24(19)15-3-7-17(8-4-15)26(30)31/h3-10H,1-2,11-14H2 |
| InChIKey | FJVAYPOYIUDMLD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 133.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|