C32H26N4O2 — CID 134566023
4-[2,5-bis(4-methylphenyl)-4-(4-nitrophenyl)pyrrolo[3,2-b]pyrrol-1-yl]aniline (PubChem CID 134566023) has the molecular formula C32H26N4O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 4-[2,5-bis(4-methylphenyl)-4-(4-nitrophenyl)pyrrolo[3,2-b]pyrrol-1-yl]aniline.
| Compound Name | 4-[2,5-bis(4-methylphenyl)-4-(4-nitrophenyl)pyrrolo[3,2-b]pyrrol-1-yl]aniline |
|---|---|
| PubChem CID | 134566023 |
| Molecular Formula | C32H26N4O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 4-[2,5-bis(4-methylphenyl)-4-(4-nitrophenyl)pyrrolo[3,2-b]pyrrol-1-yl]aniline |
| SMILES | Cc1ccc(-c2cc3c(cc(-c4ccc(C)cc4)n3-c3ccc([N+](=O)[O-])cc3)n2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C32H26N4O2/c1-21-3-7-23(8-4-21)29-19-32-31(34(29)26-13-11-25(33)12-14-26)20-30(24-9-5-22(2)6-10-24)35(32)27-15-17-28(18-16-27)36(37)38/h3-20H,33H2,1-2H3 |
| InChIKey | SCHCEYAPGFJBKQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|