C32H24Br2N2 — CID 90139024
1,4-bis(4-bromophenyl)-2,5-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole (PubChem CID 90139024) has the molecular formula C32H24Br2N2 and a molecular weight of 596.37 g/mol. Its IUPAC name is 1,4-bis(4-bromophenyl)-2,5-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole.
| Compound Name | 1,4-bis(4-bromophenyl)-2,5-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 90139024 |
| Molecular Formula | C32H24Br2N2 |
| Molecular Weight | 596.37 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | 1,4-bis(4-bromophenyl)-2,5-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole |
| SMILES | Cc1ccc(-c2cc3c(cc(-c4ccc(C)cc4)n3-c3ccc(Br)cc3)n2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C32H24Br2N2/c1-21-3-7-23(8-4-21)29-19-31-32(35(29)27-15-11-25(33)12-16-27)20-30(24-9-5-22(2)6-10-24)36(31)28-17-13-26(34)14-18-28/h3-20H,1-2H3 |
| InChIKey | YKWHCAIIEQYRPO-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.37 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |