C14H10N4O2S — CID 12706518
3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-imine (PubChem CID 12706518) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-imine.
| Compound Name | 3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 12706518 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-imine |
| SMILES | [H]/N=c1\sc(-c2ccccc2)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10N4O2S/c15-14-17(11-6-8-12(9-7-11)18(19)20)16-13(21-14)10-4-2-1-3-5-10/h1-9,15H/b15-14- |
| InChIKey | KLUAHWMNXZYIEO-PFONDFGASA-N |
| XLogP | 2.99 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|