C16H14Cl2N2S2 — CID 2806580
4-(4-chlorophenyl)-3-(3-methylsulfanylphenyl)-1,3-thiazol-2-imine;hydrochloride (PubChem CID 2806580) has the molecular formula C16H14Cl2N2S2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-(3-methylsulfanylphenyl)-1,3-thiazol-2-imine;hydrochloride.
| Compound Name | 4-(4-chlorophenyl)-3-(3-methylsulfanylphenyl)-1,3-thiazol-2-imine;hydrochloride |
|---|---|
| PubChem CID | 2806580 |
| Molecular Formula | C16H14Cl2N2S2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 4-(4-chlorophenyl)-3-(3-methylsulfanylphenyl)-1,3-thiazol-2-imine;hydrochloride |
| SMILES | Cl.[H]/N=c1\scc(-c2ccc(Cl)cc2)n1-c1cccc(SC)c1 |
| InChI | InChI=1S/C16H13ClN2S2.ClH/c1-20-14-4-2-3-13(9-14)19-15(10-21-16(19)18)11-5-7-12(17)8-6-11;/h2-10,18H,1H3;1H/b18-16-; |
| InChIKey | VDCUBVPDANDELA-FTUZMNKQSA-N |
| XLogP | 5.48 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|