C16H17N3S2 — CID 8878280
4-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-1,3-thiazol-2-amine (PubChem CID 8878280) has the molecular formula C16H17N3S2 and a molecular weight of 315.47 g/mol. Its IUPAC name is 4-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8878280 |
| Molecular Formula | C16H17N3S2 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-1,3-thiazol-2-amine |
| SMILES | CSc1cccc(-n2c(C)cc(-c3csc(N)n3)c2C)c1 |
| InChI | InChI=1S/C16H17N3S2/c1-10-7-14(15-9-21-16(17)18-15)11(2)19(10)12-5-4-6-13(8-12)20-3/h4-9H,1-3H3,(H2,17,18) |
| InChIKey | ADLFOGJOAGVQFK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|