C17H16FN3OS — CID 9174059
2-[4-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]acetamide (PubChem CID 9174059) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[4-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9174059 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[4-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(-c2csc(CC(N)=O)n2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H16FN3OS/c1-10-6-14(15-9-23-17(20-15)8-16(19)22)11(2)21(10)13-5-3-4-12(18)7-13/h3-7,9H,8H2,1-2H3,(H2,19,22) |
| InChIKey | OYRCGPXLMWZCPE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|