C21H18FN3O3S — CID 8818121
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate (PubChem CID 8818121) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate |
|---|---|
| PubChem CID | 8818121 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate |
| SMILES | Cc1cc(C(=O)COC(=O)Cc2cn3ccsc3n2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H18FN3O3S/c1-13-8-18(14(2)25(13)17-5-3-4-15(22)9-17)19(26)12-28-20(27)10-16-11-24-6-7-29-21(24)23-16/h3-9,11H,10,12H2,1-2H3 |
| InChIKey | LWJYMYPYAYKBOL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|