C18H19N3O3S — CID 8816873
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate (PubChem CID 8816873) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate |
|---|---|
| PubChem CID | 8816873 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)Cc2cn3ccsc3n2)c1C |
| InChI | InChI=1S/C18H19N3O3S/c1-4-5-21-12(2)8-15(13(21)3)16(22)11-24-17(23)9-14-10-20-6-7-25-18(20)19-14/h4,6-8,10H,1,5,9,11H2,2-3H3 |
| InChIKey | ACTRSBPZUNPRDH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|