C19H16FN3O3 — CID 7259436
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 7259436) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7259436 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cnccn2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H16FN3O3/c1-12-8-16(13(2)23(12)15-5-3-4-14(20)9-15)18(24)11-26-19(25)17-10-21-6-7-22-17/h3-10H,11H2,1-2H3 |
| InChIKey | LKGGHUQQLMUDPV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|