C24H22FN3OS — CID 8963602
2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N-(2-methylphenyl)acetamide (PubChem CID 8963602) has the molecular formula C24H22FN3OS and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8963602 |
| Molecular Formula | C24H22FN3OS |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cc1nc(-c2cc(C)n(-c3ccccc3F)c2C)cs1 |
| InChI | InChI=1S/C24H22FN3OS/c1-15-8-4-6-10-20(15)26-23(29)13-24-27-21(14-30-24)18-12-16(2)28(17(18)3)22-11-7-5-9-19(22)25/h4-12,14H,13H2,1-3H3,(H,26,29) |
| InChIKey | UCESGUVKHYBFNM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|