C24H22N2OS — CID 149292055
1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-(4-phenyl-1,3-thiazol-2-yl)ethanone (PubChem CID 149292055) has the molecular formula C24H22N2OS and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-(4-phenyl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-(4-phenyl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 149292055 |
| Molecular Formula | C24H22N2OS |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-(4-phenyl-1,3-thiazol-2-yl)ethanone |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)Cc3nc(-c4ccccc4)cs3)c2C)cc1 |
| InChI | InChI=1S/C24H22N2OS/c1-16-9-11-20(12-10-16)26-17(2)13-21(18(26)3)23(27)14-24-25-22(15-28-24)19-7-5-4-6-8-19/h4-13,15H,14H2,1-3H3 |
| InChIKey | XVAXIRSNMQGDQF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|