C22H19ClN4OS — CID 56586091
1-(3-chlorophenyl)-2,5-dimethyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrrole-3-carboxamide (PubChem CID 56586091) has the molecular formula C22H19ClN4OS and a molecular weight of 422.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,5-dimethyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-2,5-dimethyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56586091 |
| Molecular Formula | C22H19ClN4OS |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2,5-dimethyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2nc(-c3ccncc3)cs2)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H19ClN4OS/c1-14-10-19(15(2)27(14)18-5-3-4-17(23)11-18)22(28)25-12-21-26-20(13-29-21)16-6-8-24-9-7-16/h3-11,13H,12H2,1-2H3,(H,25,28) |
| InChIKey | YAAOGUXVEBFUDQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|