C18H22ClN3O2 — CID 120947653
1-(3-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 120947653) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 120947653 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2CNCC2O)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-11-6-16(18(24)21-9-13-8-20-10-17(13)23)12(2)22(11)15-5-3-4-14(19)7-15/h3-7,13,17,20,23H,8-10H2,1-2H3,(H,21,24) |
| InChIKey | UEPPOOWDBABCRB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|