C19H25Cl2N3O — CID 120556705
1-(3-chlorophenyl)-2,5-dimethyl-N-(3-methylpiperidin-4-yl)pyrrole-3-carboxamide;hydrochloride (PubChem CID 120556705) has the molecular formula C19H25Cl2N3O and a molecular weight of 382.34 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,5-dimethyl-N-(3-methylpiperidin-4-yl)pyrrole-3-carboxamide;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)-2,5-dimethyl-N-(3-methylpiperidin-4-yl)pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120556705 |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-(3-chlorophenyl)-2,5-dimethyl-N-(3-methylpiperidin-4-yl)pyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC2CCNCC2C)c(C)n1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C19H24ClN3O.ClH/c1-12-11-21-8-7-18(12)22-19(24)17-9-13(2)23(14(17)3)16-6-4-5-15(20)10-16;/h4-6,9-10,12,18,21H,7-8,11H2,1-3H3,(H,22,24);1H |
| InChIKey | MEEVKVJAVZSSIW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|