C16H24Cl2N2O — CID 120554098
2-(3-chlorophenyl)-2-methyl-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride (PubChem CID 120554098) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-methyl-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride.
| Compound Name | 2-(3-chlorophenyl)-2-methyl-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120554098 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-(3-chlorophenyl)-2-methyl-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride |
| SMILES | CC1CNCCC1NC(=O)C(C)(C)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C16H23ClN2O.ClH/c1-11-10-18-8-7-14(11)19-15(20)16(2,3)12-5-4-6-13(17)9-12;/h4-6,9,11,14,18H,7-8,10H2,1-3H3,(H,19,20);1H |
| InChIKey | YZKNJVUDVOHVFG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |