C30H26N2O2S — CID 2077813
(2S)-2-(1,3-benzothiazol-2-yl)-4-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-phenylbutane-1,4-dione (PubChem CID 2077813) has the molecular formula C30H26N2O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-yl)-4-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-phenylbutane-1,4-dione.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-yl)-4-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 2077813 |
| Molecular Formula | C30H26N2O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-yl)-4-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-phenylbutane-1,4-dione |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)C[C@@H](C(=O)c3ccccc3)c3nc4ccccc4s3)c2C)cc1 |
| InChI | InChI=1S/C30H26N2O2S/c1-19-13-15-23(16-14-19)32-20(2)17-24(21(32)3)27(33)18-25(29(34)22-9-5-4-6-10-22)30-31-26-11-7-8-12-28(26)35-30/h4-17,25H,18H2,1-3H3/t25-/m0/s1 |
| InChIKey | BXJZIACKAMLYBN-VWLOTQADSA-N |
| XLogP | 7.25 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|