C26H28N2O4 — CID 55379069
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-acetamido-3-(4-methylphenyl)propanoate (PubChem CID 55379069) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-acetamido-3-(4-methylphenyl)propanoate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-acetamido-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 55379069 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-acetamido-3-(4-methylphenyl)propanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)c1cc(C)n(-c2ccccc2)c1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-17-10-12-21(13-11-17)24(27-20(4)29)15-26(31)32-16-25(30)23-14-18(2)28(19(23)3)22-8-6-5-7-9-22/h5-14,24H,15-16H2,1-4H3,(H,27,29) |
| InChIKey | LCBOREFIXFITJF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|