C27H26N2O5S — CID 2484920
[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetate (PubChem CID 2484920) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetate.
| Compound Name | [2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 2484920 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)CS[C@H]3CC(=O)N(c4ccccc4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c1-17-9-11-21(12-10-17)28-18(2)13-22(19(28)3)23(30)15-34-26(32)16-35-24-14-25(31)29(27(24)33)20-7-5-4-6-8-20/h4-13,24H,14-16H2,1-3H3/t24-/m0/s1 |
| InChIKey | CGOLCCSACQLNDZ-DEOSSOPVSA-N |
| XLogP | 4.19 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|