C26H22ClNO3S — CID 4009249
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate (PubChem CID 4009249) has the molecular formula C26H22ClNO3S and a molecular weight of 463.99 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
|---|---|
| PubChem CID | 4009249 |
| Molecular Formula | C26H22ClNO3S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
| SMILES | Cc1cc(C(=O)COC(=O)CSc2cccc3cccc(Cl)c23)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C26H22ClNO3S/c1-17-14-21(18(2)28(17)20-10-4-3-5-11-20)23(29)15-31-25(30)16-32-24-13-7-9-19-8-6-12-22(27)26(19)24/h3-14H,15-16H2,1-2H3 |
| InChIKey | QAJZKUPOLLJITF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|