C22H28N2O4 — CID 18280280
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate (PubChem CID 18280280) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 18280280 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate |
| SMILES | Cc1cc(C(=O)COC(=O)C(C)NC(=O)C(C)(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c1-14-12-18(16(3)24(14)17-10-8-7-9-11-17)19(25)13-28-20(26)15(2)23-21(27)22(4,5)6/h7-12,15H,13H2,1-6H3,(H,23,27) |
| InChIKey | UELCHVXHBHRACP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|