C26H28N2O5 — CID 55886396
[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-hydroxypropanoate (PubChem CID 55886396) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-hydroxypropanoate.
| Compound Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 55886396 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-hydroxypropanoate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)C(CO)NC(=O)c3ccccc3)c2C)cc1C |
| InChI | InChI=1S/C26H28N2O5/c1-16-10-11-21(12-17(16)2)28-18(3)13-22(19(28)4)24(30)15-33-26(32)23(14-29)27-25(31)20-8-6-5-7-9-20/h5-13,23,29H,14-15H2,1-4H3,(H,27,31) |
| InChIKey | YADBQGOLAFLORX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|