C25H27NO4S — CID 46692470
[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methylsulfinylmethyl)benzoate (PubChem CID 46692470) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methylsulfinylmethyl)benzoate.
| Compound Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methylsulfinylmethyl)benzoate |
|---|---|
| PubChem CID | 46692470 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methylsulfinylmethyl)benzoate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)c3cccc(CS(C)=O)c3)c2C)cc1C |
| InChI | InChI=1S/C25H27NO4S/c1-16-9-10-22(11-17(16)2)26-18(3)12-23(19(26)4)24(27)14-30-25(28)21-8-6-7-20(13-21)15-31(5)29/h6-13H,14-15H2,1-5H3 |
| InChIKey | CWHWIHIVLWRGMU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|