C22H28N2O5 — CID 40683266
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 40683266) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 40683266 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | Cc1cc(C(=O)COC(=O)CCNC(=O)OC(C)(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H28N2O5/c1-15-13-18(16(2)24(15)17-9-7-6-8-10-17)19(25)14-28-20(26)11-12-23-21(27)29-22(3,4)5/h6-10,13H,11-12,14H2,1-5H3,(H,23,27) |
| InChIKey | WROUTDFLSCNHMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|