C22H20F3NO5 — CID 42941957
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanoate (PubChem CID 42941957) has the molecular formula C22H20F3NO5 and a molecular weight of 435.40 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanoate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 42941957 |
| Molecular Formula | C22H20F3NO5 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanoate |
| SMILES | Cc1cc(C(=O)COC(=O)CC(O)(c2ccco2)C(F)(F)F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H20F3NO5/c1-14-11-17(15(2)26(14)16-7-4-3-5-8-16)18(27)13-31-20(28)12-21(29,22(23,24)25)19-9-6-10-30-19/h3-11,29H,12-13H2,1-2H3 |
| InChIKey | VBZJYNTTXBOARQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|