C18H18ClN3OS — CID 9174035
2-[4-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-5-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 9174035) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-[4-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-5-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-5-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9174035 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[4-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-5-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1sc(CC(N)=O)nc1-c1cc(C)n(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C18H18ClN3OS/c1-10-8-15(18-12(3)24-17(21-18)9-16(20)23)11(2)22(10)14-6-4-13(19)5-7-14/h4-8H,9H2,1-3H3,(H2,20,23) |
| InChIKey | HNHOLJMGRVDNMD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|