C14H14ClNO3 — CID 155135193
2-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-hydroxyacetic acid (PubChem CID 155135193) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-hydroxyacetic acid.
| Compound Name | 2-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 155135193 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-hydroxyacetic acid |
| SMILES | Cc1cc(C(O)C(=O)O)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClNO3/c1-8-7-12(13(17)14(18)19)9(2)16(8)11-5-3-10(15)4-6-11/h3-7,13,17H,1-2H3,(H,18,19) |
| InChIKey | BIADBTTUAQNULF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|