C12H9F2NOS — CID 116966432
1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]propan-2-one (PubChem CID 116966432) has the molecular formula C12H9F2NOS and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]propan-2-one.
| Compound Name | 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]propan-2-one |
|---|---|
| PubChem CID | 116966432 |
| Molecular Formula | C12H9F2NOS |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]propan-2-one |
| SMILES | CC(=O)Cc1nc(-c2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C12H9F2NOS/c1-7(16)4-12-15-11(6-17-12)9-3-2-8(13)5-10(9)14/h2-3,5-6H,4H2,1H3 |
| InChIKey | LFWXKWRFWZOSIG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |