C16H9F2NOS — CID 63102442
[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone (PubChem CID 63102442) has the molecular formula C16H9F2NOS and a molecular weight of 301.32 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone.
| Compound Name | [4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 63102442 |
| Molecular Formula | C16H9F2NOS |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1nc(-c2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C16H9F2NOS/c17-11-6-7-12(13(18)8-11)14-9-21-16(19-14)15(20)10-4-2-1-3-5-10/h1-9H |
| InChIKey | MAUGNJUBKZOJDQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |