C16H10FNOS — CID 63102619
[4-(2-fluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone (PubChem CID 63102619) has the molecular formula C16H10FNOS and a molecular weight of 283.33 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone.
| Compound Name | [4-(2-fluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 63102619 |
| Molecular Formula | C16H10FNOS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | [4-(2-fluorophenyl)-1,3-thiazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1nc(-c2ccccc2F)cs1 |
| InChI | InChI=1S/C16H10FNOS/c17-13-9-5-4-8-12(13)14-10-20-16(18-14)15(19)11-6-2-1-3-7-11/h1-10H |
| InChIKey | OORYBDBCRJFLEF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |