C24H20ClN3OS — CID 2458276
(E)-3-(4-chlorophenyl)-N-[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 2458276) has the molecular formula C24H20ClN3OS and a molecular weight of 433.96 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2458276 |
| Molecular Formula | C24H20ClN3OS |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cc(-c2csc(NC(=O)/C=C/c3ccc(Cl)cc3)n2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3OS/c1-16-14-21(17(2)28(16)20-6-4-3-5-7-20)22-15-30-24(26-22)27-23(29)13-10-18-8-11-19(25)12-9-18/h3-15H,1-2H3,(H,26,27,29)/b13-10+ |
| InChIKey | QKWYPGRQTYGIIL-JLHYYAGUSA-N |
| XLogP | 6.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|