C28H30N4O2S — CID 2456868
N-[(2S,3R)-1-[[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 2456868) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[(2S,3R)-1-[[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3R)-1-[[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 2456868 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-[(2S,3R)-1-[[4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-yl]amino]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)c1ccccc1)C(=O)Nc1nc(-c2cc(C)n(-c3ccccc3)c2C)cs1 |
| InChI | InChI=1S/C28H30N4O2S/c1-5-18(2)25(30-26(33)21-12-8-6-9-13-21)27(34)31-28-29-24(17-35-28)23-16-19(3)32(20(23)4)22-14-10-7-11-15-22/h6-18,25H,5H2,1-4H3,(H,30,33)(H,29,31,34)/t18-,25+/m1/s1 |
| InChIKey | QCDQLALUVRSHOU-CJAUYULYSA-N |
| XLogP | 6.00 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|