C22H23N3O2S — CID 139386620
N-[(2S)-4-methyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]pentan-2-yl]benzamide (PubChem CID 139386620) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]pentan-2-yl]benzamide.
| Compound Name | N-[(2S)-4-methyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 139386620 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(2S)-4-methyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]pentan-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccccc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H23N3O2S/c1-15(2)13-18(23-20(26)17-11-7-4-8-12-17)21(27)25-22-24-19(14-28-22)16-9-5-3-6-10-16/h3-12,14-15,18H,13H2,1-2H3,(H,23,26)(H,24,25,27)/t18-/m0/s1 |
| InChIKey | IMPDYXSKJNHALN-SFHVURJKSA-N |
| XLogP | 4.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |