C21H22N4O2S2 — CID 139371137
4-amino-N-[4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]benzamide (PubChem CID 139371137) has the molecular formula C21H22N4O2S2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 4-amino-N-[4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]benzamide.
| Compound Name | 4-amino-N-[4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 139371137 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-amino-N-[4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(N)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H22N4O2S2/c1-28-12-11-17(23-19(26)15-7-9-16(22)10-8-15)20(27)25-21-24-18(13-29-21)14-5-3-2-4-6-14/h2-10,13,17H,11-12,22H2,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | QTPCQAYLBQHGKD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|