C24H27N5O3S2 — CID 155792373
N-[(2S)-1-[[4-[3-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-aminobenzamide (PubChem CID 155792373) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is N-[(2S)-1-[[4-[3-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-aminobenzamide.
| Compound Name | N-[(2S)-1-[[4-[3-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-aminobenzamide |
|---|---|
| PubChem CID | 155792373 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[(2S)-1-[[4-[3-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]-4-aminobenzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccc(N)cc1)C(=O)Nc1nc(-c2cccc(CNC(C)=O)c2)cs1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-15(30)26-13-16-4-3-5-18(12-16)21-14-34-24(28-21)29-23(32)20(10-11-33-2)27-22(31)17-6-8-19(25)9-7-17/h3-9,12,14,20H,10-11,13,25H2,1-2H3,(H,26,30)(H,27,31)(H,28,29,32)/t20-/m0/s1 |
| InChIKey | JCWQQFWXUHNGAI-FQEVSTJZSA-N |
| XLogP | 3.52 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|