C27H26N4O2S2 — CID 161010855
4-amino-N-[(3S)-5-methylsulfanyl-2-oxo-1-[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]pentan-3-yl]benzamide (PubChem CID 161010855) has the molecular formula C27H26N4O2S2 and a molecular weight of 502.67 g/mol. Its IUPAC name is 4-amino-N-[(3S)-5-methylsulfanyl-2-oxo-1-[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]pentan-3-yl]benzamide.
| Compound Name | 4-amino-N-[(3S)-5-methylsulfanyl-2-oxo-1-[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]pentan-3-yl]benzamide |
|---|---|
| PubChem CID | 161010855 |
| Molecular Formula | C27H26N4O2S2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 4-amino-N-[(3S)-5-methylsulfanyl-2-oxo-1-[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]pentan-3-yl]benzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccc(N)cc1)C(=O)Cc1nc(-c2cccc(-c3ccncc3)c2)cs1 |
| InChI | InChI=1S/C27H26N4O2S2/c1-34-14-11-23(31-27(33)19-5-7-22(28)8-6-19)25(32)16-26-30-24(17-35-26)21-4-2-3-20(15-21)18-9-12-29-13-10-18/h2-10,12-13,15,17,23H,11,14,16,28H2,1H3,(H,31,33)/t23-/m0/s1 |
| InChIKey | TXCMNUWRYHYMSD-QHCPKHFHSA-N |
| XLogP | 5.12 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|